CAS 2376326-31-5 appears in our catalog under these names: NPD-1335, 98.10%, 98.10%, NPD-1335, 98.10%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50 mg, 5 mg, 25 mg, 10mM/1mL, 100 mg.
3-[5-[(4aS,8aR)-4-oxo-3-propan-2-yl-4a,5,8,8a-tetrahydrophthalazin-1-yl]-2-methoxyphenyl]-N-benzylprop-2-ynamide (CAS 2376326-31-5) is a chemical compound with the molecular formula C28H29N3O3 and a molecular weight of 455.5 g/mol. IUPAC name: 3-[5-[(4aS,8aR)-4-oxo-3-propan-2-yl-4a,5,8,8a-tetrahydrophthalazin-1-yl]-2-methoxyphenyl]-N-benzylprop-2-ynamide. InChIKey: CNKULZYKNGMIIR-RPWUZVMVSA-N.
| Molecular formula | C28H29N3O3 |
|---|---|
| Molecular weight | 455.5 g/mol |
| IUPAC name | 3-[5-[(4aS,8aR)-4-oxo-3-propan-2-yl-4a,5,8,8a-tetrahydrophthalazin-1-yl]-2-methoxyphenyl]-N-benzylprop-2-ynamide |
| InChIKey | CNKULZYKNGMIIR-RPWUZVMVSA-N |
| SMILES | CC(C)N1C(=O)[C@H]2CC=CC[C@H]2C(=N1)C3=CC(=C(C=C3)OC)C#CC(=O)NCC4=CC=CC=C4 |
Computed by PubChem (NCBI)