Products 2260504-85-4
CAS 2260504-85-4 is the registry number for 2-((2S)-Pyrrolidin-2-yl)-2,3-dihydro-1H-inden-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroinden-2-ol;hydrochloride (CAS 2260504-85-4) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroinden-2-ol;hydrochloride. InChIKey: HPUQBBBIIAXDBH-YDALLXLXSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroinden-2-ol;hydrochloride |
| InChIKey | HPUQBBBIIAXDBH-YDALLXLXSA-N |
| SMILES | C1C[C@H](NC1)C2(CC3=CC=CC=C3C2)O.Cl |
Computed by PubChem (NCBI)