Products 2260810-48-6
CAS 2260810-48-6 appears in our catalog under these names: CrBKA, CrBKA, 98.46%, CrBKA, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 10 mg, 50 mg, 5 mg, 25 mg, 1mg, 5mg.
Benzyl N-[(2S)-6-[[(E)-but-2-enoyl]amino]-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]carbamate (CAS 2260810-48-6) is a chemical compound with the molecular formula C28H31N3O6 and a molecular weight of 505.6 g/mol. IUPAC name: benzyl N-[(2S)-6-[[(E)-but-2-enoyl]amino]-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]carbamate. InChIKey: MZNAVDKTIVTYMY-BSQRELMASA-N.
| Molecular formula | C28H31N3O6 |
|---|---|
| Molecular weight | 505.6 g/mol |
| IUPAC name | benzyl N-[(2S)-6-[[(E)-but-2-enoyl]amino]-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]carbamate |
| InChIKey | MZNAVDKTIVTYMY-BSQRELMASA-N |
| SMILES | C/C=C/C(=O)NCCCC[C@@H](C(=O)NC1=CC2=C(C=C1)C(=CC(=O)O2)C)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
CrBKA