CAS 2260871-89-2 is the registry number for 4,4'-(Dibenzofuran-2,8-diyl) dianiline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
4-[8-(4-aminophenyl)dibenzofuran-2-yl]aniline (CAS 2260871-89-2) is a chemical compound with the molecular formula C24H18N2O and a molecular weight of 350.4 g/mol. IUPAC name: 4-[8-(4-aminophenyl)dibenzofuran-2-yl]aniline. InChIKey: REAGXULQJRHTNR-UHFFFAOYSA-N.
| Molecular formula | C24H18N2O |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 4-[8-(4-aminophenyl)dibenzofuran-2-yl]aniline |
| InChIKey | REAGXULQJRHTNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(C=C2)OC4=C3C=C(C=C4)C5=CC=C(C=C5)N)N |
Computed by PubChem (NCBI)