CAS 2411386-00-8 appears in our catalog under these names: (4S,5R)–4,5–Diphenyl–2–(quinolin–2–yl)–4,5–dihydrooxazole, (S,R)-BisPh-Quinox, 95%, 95%, (4S,5R)-4,5-Diphenyl-2-(quinolin-2-yl)-4,5-dihydrooxazole, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(4S,5R)-4,5-diphenyl-2-quinolin-2-yl-4,5-dihydro-1,3-oxazole (CAS 2411386-00-8) is a chemical compound with the molecular formula C24H18N2O and a molecular weight of 350.4 g/mol. IUPAC name: (4S,5R)-4,5-diphenyl-2-quinolin-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: RLOADAOBQOTJID-XZOQPEGZSA-N.
| Molecular formula | C24H18N2O |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | (4S,5R)-4,5-diphenyl-2-quinolin-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | RLOADAOBQOTJID-XZOQPEGZSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]2[C@H](OC(=N2)C3=NC4=CC=CC=C4C=C3)C5=CC=CC=C5 |
Computed by PubChem (NCBI)