CAS 2260936-19-2 is the registry number for (5-Fluoro-1-benzofuran-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-fluoro-1-benzofuran-3-yl)methanamine;hydrochloride (CAS 2260936-19-2) is a chemical compound with the molecular formula C9H9ClFNO and a molecular weight of 201.62 g/mol. IUPAC name: (5-fluoro-1-benzofuran-3-yl)methanamine;hydrochloride. InChIKey: YBKUEFDXEGBNMQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFNO |
|---|---|
| Molecular weight | 201.62 g/mol |
| IUPAC name | (5-fluoro-1-benzofuran-3-yl)methanamine;hydrochloride |
| InChIKey | YBKUEFDXEGBNMQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CO2)CN.Cl |
Computed by PubChem (NCBI)