CAS 2260937-61-7 appears in our catalog under these names: 3-Bromo-6,7-dihydro-5H-cyclopenta(b)pyridin-6-amine hydrochloride, 98%, 3-Bromo-6,7-dihydro-5H-cyclopenta(b)pyridin-6-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridin-6-amine;dihydrochloride (CAS 2260937-61-7) is a chemical compound with the molecular formula C8H11BrCl2N2 and a molecular weight of 285.99 g/mol. IUPAC name: 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridin-6-amine;dihydrochloride. InChIKey: VPNUUGLXCSSCBA-UHFFFAOYSA-N.
| Molecular formula | C8H11BrCl2N2 |
|---|---|
| Molecular weight | 285.99 g/mol |
| IUPAC name | 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridin-6-amine;dihydrochloride |
| InChIKey | VPNUUGLXCSSCBA-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=C(C=N2)Br)N.Cl.Cl |
Computed by PubChem (NCBI)