Products 2306268-58-4
CAS 2306268-58-4 is the registry number for 4-Bromoindolin-7-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-2,3-dihydro-1H-indol-7-amine;dihydrochloride (CAS 2306268-58-4) is a chemical compound with the molecular formula C8H11BrCl2N2 and a molecular weight of 285.99 g/mol. IUPAC name: 4-bromo-2,3-dihydro-1H-indol-7-amine;dihydrochloride. InChIKey: CZLCSGURDQFPFB-UHFFFAOYSA-N.
| Molecular formula | C8H11BrCl2N2 |
|---|---|
| Molecular weight | 285.99 g/mol |
| IUPAC name | 4-bromo-2,3-dihydro-1H-indol-7-amine;dihydrochloride |
| InChIKey | CZLCSGURDQFPFB-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=CC(=C21)Br)N.Cl.Cl |
Computed by PubChem (NCBI)