CAS 22652-14-8 is the registry number for 2,6-Dichloro-4-(trichloromethyl)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
2,6-dichloro-4-(trichloromethyl)pyridine (CAS 22652-14-8) is a chemical compound with the molecular formula C6H2Cl5N and a molecular weight of 265.3 g/mol. IUPAC name: 2,6-dichloro-4-(trichloromethyl)pyridine. InChIKey: YNSFPJXGPWKOGD-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl5N |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | 2,6-dichloro-4-(trichloromethyl)pyridine |
| InChIKey | YNSFPJXGPWKOGD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)