CAS 69045-83-6 appears in our catalog under these names: 2,3-Dichloro-5-(trichloromethyl)pyridine 95%, 2,3-Dichloro-5-(trichloromethyl)pyridine, 95%, 95%, 2,3-Dichloro-5-(trichloromethyl)pyridine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
2,3-dichloro-5-(trichloromethyl)pyridine (CAS 69045-83-6) is a chemical compound with the molecular formula C6H2Cl5N and a molecular weight of 265.3 g/mol. IUPAC name: 2,3-dichloro-5-(trichloromethyl)pyridine. InChIKey: XVBWGQSXLITICX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl5N |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | 2,3-dichloro-5-(trichloromethyl)pyridine |
| InChIKey | XVBWGQSXLITICX-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)