Products 2270905-50-3

CAS 2270905-50-3 is the registry number for 5-(4,4-Difluoro-piperidin-1-yl)-pentanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(4,4-difluoropiperidin-1-yl)pentanoic acid;hydrochloride (CAS 2270905-50-3) is a chemical compound with the molecular formula C10H18ClF2NO2 and a molecular weight of 257.70 g/mol. IUPAC name: 5-(4,4-difluoropiperidin-1-yl)pentanoic acid;hydrochloride. InChIKey: PARFGGAHDZQNEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18ClF2NO2
Molecular weight257.70 g/mol
IUPAC name5-(4,4-difluoropiperidin-1-yl)pentanoic acid;hydrochloride
InChIKeyPARFGGAHDZQNEZ-UHFFFAOYSA-N
SMILESC1CN(CCC1(F)F)CCCCC(=O)O.Cl

Computed by PubChem (NCBI)