CAS 2306246-93-3 is the registry number for Methyl (R)-2-amino-3-(4,4-difluorocyclohexyl)propanoate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoate;hydrochloride (CAS 2306246-93-3) is a chemical compound with the molecular formula C10H18ClF2NO2 and a molecular weight of 257.70 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoate;hydrochloride. InChIKey: FPDUMVCAOUQLJR-DDWIOCJRSA-N.
| Molecular formula | C10H18ClF2NO2 |
|---|---|
| Molecular weight | 257.70 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoate;hydrochloride |
| InChIKey | FPDUMVCAOUQLJR-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](CC1CCC(CC1)(F)F)N.Cl |
Computed by PubChem (NCBI)