Products 2270905-77-4

CAS 2270905-77-4 is the registry number for 4-Piperidin-4-yl-2-trifluoromethyl-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-piperidin-4-yl-2-(trifluoromethyl)benzoate (CAS 2270905-77-4) is a chemical compound with the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. IUPAC name: methyl 4-piperidin-4-yl-2-(trifluoromethyl)benzoate. InChIKey: UAOJMNSXAVTJME-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16F3NO2
Molecular weight287.28 g/mol
IUPAC namemethyl 4-piperidin-4-yl-2-(trifluoromethyl)benzoate
InChIKeyUAOJMNSXAVTJME-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)C2CCNCC2)C(F)(F)F

Computed by PubChem (NCBI)