Products 3078559-89-1
CAS 3078559-89-1 is the registry number for 3-(1-Methylpiperidin-4-yl)-5-(trifluoromethyl)benzoic acid, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-(1-methylpiperidin-4-yl)-5-(trifluoromethyl)benzoic acid (CAS 3078559-89-1) is a chemical compound with the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. IUPAC name: 3-(1-methylpiperidin-4-yl)-5-(trifluoromethyl)benzoic acid. InChIKey: SZCODOJSXGFCQU-UHFFFAOYSA-N.
| Molecular formula | C14H16F3NO2 |
|---|---|
| Molecular weight | 287.28 g/mol |
| IUPAC name | 3-(1-methylpiperidin-4-yl)-5-(trifluoromethyl)benzoic acid |
| InChIKey | SZCODOJSXGFCQU-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)C2=CC(=CC(=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)