CAS 263550-60-3 is the registry number for tert-Butyl 6-bromo-4,4-dimethyl-3,4-dihydroquinoline-1(2H)-carboxylate, 96%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 6-bromo-4,4-dimethyl-2,3-dihydroquinoline-1-carboxylate (CAS 263550-60-3) is a chemical compound with the molecular formula C16H22BrNO2 and a molecular weight of 340.25 g/mol. IUPAC name: tert-butyl 6-bromo-4,4-dimethyl-2,3-dihydroquinoline-1-carboxylate. InChIKey: PVUAPECQGXLGSZ-UHFFFAOYSA-N.
| Molecular formula | C16H22BrNO2 |
|---|---|
| Molecular weight | 340.25 g/mol |
| IUPAC name | tert-butyl 6-bromo-4,4-dimethyl-2,3-dihydroquinoline-1-carboxylate |
| InChIKey | PVUAPECQGXLGSZ-UHFFFAOYSA-N |
| SMILES | CC1(CCN(C2=C1C=C(C=C2)Br)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)