Products 2270907-16-7

CAS 2270907-16-7 is the registry number for 2-(5-Fluoro-2-methoxy-phenoxy)-2-methyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(5-fluoro-2-methoxyphenoxy)-2-methylpropanoic acid (CAS 2270907-16-7) is a chemical compound with the molecular formula C11H13FO4 and a molecular weight of 228.22 g/mol. IUPAC name: 2-(5-fluoro-2-methoxyphenoxy)-2-methylpropanoic acid. InChIKey: HBXGRZNQKPWNMS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13FO4
Molecular weight228.22 g/mol
IUPAC name2-(5-fluoro-2-methoxyphenoxy)-2-methylpropanoic acid
InChIKeyHBXGRZNQKPWNMS-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)OC1=C(C=CC(=C1)F)OC

Computed by PubChem (NCBI)