Products 2807471-64-1

CAS 2807471-64-1 is the registry number for 5-Fluoro-4-isopropoxy-2-methoxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-fluoro-2-methoxy-4-propan-2-yloxybenzoic acid (CAS 2807471-64-1) is a chemical compound with the molecular formula C11H13FO4 and a molecular weight of 228.22 g/mol. IUPAC name: 5-fluoro-2-methoxy-4-propan-2-yloxybenzoic acid. InChIKey: WIAVPWXXOSXAGB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13FO4
Molecular weight228.22 g/mol
IUPAC name5-fluoro-2-methoxy-4-propan-2-yloxybenzoic acid
InChIKeyWIAVPWXXOSXAGB-UHFFFAOYSA-N
SMILESCC(C)OC1=C(C=C(C(=C1)OC)C(=O)O)F

Computed by PubChem (NCBI)