Products 2270907-87-2

CAS 2270907-87-2 is the registry number for 3-(4-Hydroxy-pyrazol-1-yl)-azetidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Tert-butyl 3-(4-hydroxypyrazol-1-yl)azetidine-1-carboxylate (CAS 2270907-87-2) is a chemical compound with the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. IUPAC name: tert-butyl 3-(4-hydroxypyrazol-1-yl)azetidine-1-carboxylate. InChIKey: IQHZGDBJLCOYIK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17N3O3
Molecular weight239.27 g/mol
IUPAC nametert-butyl 3-(4-hydroxypyrazol-1-yl)azetidine-1-carboxylate
InChIKeyIQHZGDBJLCOYIK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(C1)N2C=C(C=N2)O

Computed by PubChem (NCBI)