CAS 497228-78-1 is the registry number for Isopropyl 3-(2-amino-4-hydroxy-6-methyl-5-pyrimidinyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Propan-2-yl 3-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propanoate (CAS 497228-78-1) is a chemical compound with the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. IUPAC name: propan-2-yl 3-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propanoate. InChIKey: IKDMULZBPOZJQM-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O3 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | propan-2-yl 3-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propanoate |
| InChIKey | IKDMULZBPOZJQM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=N1)N)CCC(=O)OC(C)C |
Computed by PubChem (NCBI)