Products 2270908-73-9
CAS 2270908-73-9 is the registry number for 1-(4-Bromo-3-fluoro-benzenesulfonyl)-3,3-difluoro-pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(4-bromo-3-fluorophenyl)sulfonyl-3,3-difluoropyrrolidine (CAS 2270908-73-9) is a chemical compound with the molecular formula C10H9BrF3NO2S and a molecular weight of 344.15 g/mol. IUPAC name: 1-(4-bromo-3-fluorophenyl)sulfonyl-3,3-difluoropyrrolidine. InChIKey: DLMXMISILMCZCQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO2S |
|---|---|
| Molecular weight | 344.15 g/mol |
| IUPAC name | 1-(4-bromo-3-fluorophenyl)sulfonyl-3,3-difluoropyrrolidine |
| InChIKey | DLMXMISILMCZCQ-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)S(=O)(=O)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)