Products 2504203-08-9
CAS 2504203-08-9 is the registry number for N-(5-Bromo-2-(trifluoromethyl)phenyl)cyclopropanesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[5-bromo-2-(trifluoromethyl)phenyl]cyclopropanesulfonamide (CAS 2504203-08-9) is a chemical compound with the molecular formula C10H9BrF3NO2S and a molecular weight of 344.15 g/mol. IUPAC name: N-[5-bromo-2-(trifluoromethyl)phenyl]cyclopropanesulfonamide. InChIKey: NFINRUSJZVLLLD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO2S |
|---|---|
| Molecular weight | 344.15 g/mol |
| IUPAC name | N-[5-bromo-2-(trifluoromethyl)phenyl]cyclopropanesulfonamide |
| InChIKey | NFINRUSJZVLLLD-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)NC2=C(C=CC(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)