Products 2270909-62-9
CAS 2270909-62-9 is the registry number for 5-Bromo-n-methyl-2-(2,2,2-trifluoro-ethoxy)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-N-methyl-2-(2,2,2-trifluoroethoxy)benzamide (CAS 2270909-62-9) is a chemical compound with the molecular formula C10H9BrF3NO2 and a molecular weight of 312.08 g/mol. IUPAC name: 5-bromo-N-methyl-2-(2,2,2-trifluoroethoxy)benzamide. InChIKey: LJGKLJUFTXRALJ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO2 |
|---|---|
| Molecular weight | 312.08 g/mol |
| IUPAC name | 5-bromo-N-methyl-2-(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | LJGKLJUFTXRALJ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=CC(=C1)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)