Products 2504203-46-5
CAS 2504203-46-5 is the registry number for 2-Bromo-n-methyl-3-(2,2,2-trifluoroethoxy)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-bromo-N-methyl-3-(2,2,2-trifluoroethoxy)benzamide (CAS 2504203-46-5) is a chemical compound with the molecular formula C10H9BrF3NO2 and a molecular weight of 312.08 g/mol. IUPAC name: 2-bromo-N-methyl-3-(2,2,2-trifluoroethoxy)benzamide. InChIKey: ISSZVTBHIMHTBU-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO2 |
|---|---|
| Molecular weight | 312.08 g/mol |
| IUPAC name | 2-bromo-N-methyl-3-(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | ISSZVTBHIMHTBU-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C(=CC=C1)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)