CAS 2270911-31-2 appears in our catalog under these names: 3-(4-Chloro-2-formyl-phenoxy)-azetidine-1-carboxylic acid tert-butyl ester, 95%, tert-Butyl 3-(4-chloro-2-formylphenoxy)azetidine-1-carboxylate 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 25mg, 50mg, 100mg, 250mg.
Tert-butyl 3-(4-chloro-2-formylphenoxy)azetidine-1-carboxylate (CAS 2270911-31-2) is a chemical compound with the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. IUPAC name: tert-butyl 3-(4-chloro-2-formylphenoxy)azetidine-1-carboxylate. InChIKey: HLQOMXCATMBAPS-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO4 |
|---|---|
| Molecular weight | 311.76 g/mol |
| IUPAC name | tert-butyl 3-(4-chloro-2-formylphenoxy)azetidine-1-carboxylate |
| InChIKey | HLQOMXCATMBAPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)OC2=C(C=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)