Products 791607-31-3
CAS 791607-31-3 is the registry number for Ethyl (2e)-2-(chloroacetyl)-3-[(4-methoxyphenyl)amino]but-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Ethyl (E)-4-chloro-3-hydroxy-2-[N-(4-methoxyphenyl)-C-methylcarbonimidoyl]but-2-enoate (CAS 791607-31-3) is a chemical compound with the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. IUPAC name: ethyl (E)-4-chloro-3-hydroxy-2-[N-(4-methoxyphenyl)-C-methylcarbonimidoyl]but-2-enoate. InChIKey: IWPBATCWPRFKBW-IFLUOOMFSA-N.
| Molecular formula | C15H18ClNO4 |
|---|---|
| Molecular weight | 311.76 g/mol |
| IUPAC name | ethyl (E)-4-chloro-3-hydroxy-2-[N-(4-methoxyphenyl)-C-methylcarbonimidoyl]but-2-enoate |
| InChIKey | IWPBATCWPRFKBW-IFLUOOMFSA-N |
| SMILES | CCOC(=O)/C(=C(\CCl)/O)/C(=NC1=CC=C(C=C1)OC)C |
Computed by PubChem (NCBI)