Products 2270912-42-8

CAS 2270912-42-8 is the registry number for [3-(3-Hydroxy-azetidin-1-yl)-propyl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[3-(3-hydroxyazetidin-1-yl)propyl]carbamate (CAS 2270912-42-8) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl N-[3-(3-hydroxyazetidin-1-yl)propyl]carbamate. InChIKey: YDCMKCFKGXYSIS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22N2O3
Molecular weight230.30 g/mol
IUPAC nametert-butyl N-[3-(3-hydroxyazetidin-1-yl)propyl]carbamate
InChIKeyYDCMKCFKGXYSIS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCCN1CC(C1)O

Computed by PubChem (NCBI)