CAS 2270912-44-0 is the registry number for 1-(2,4-Difluorophenyl)-3-methylenepyrrolidine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2,4-difluorophenyl)-3-methylidenepyrrolidine-2,5-dione (CAS 2270912-44-0) is a chemical compound with the molecular formula C11H7F2NO2 and a molecular weight of 223.17 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-3-methylidenepyrrolidine-2,5-dione. InChIKey: GUSGRGMPEDNRNA-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO2 |
|---|---|
| Molecular weight | 223.17 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-3-methylidenepyrrolidine-2,5-dione |
| InChIKey | GUSGRGMPEDNRNA-UHFFFAOYSA-N |
| SMILES | C=C1CC(=O)N(C1=O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)