CAS 831191-79-8 is the registry number for 5(4H)-Oxazolone, 4-[(2,4-difluorophenyl)methylene]-2-methyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-[(2,4-difluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one (CAS 831191-79-8) is a chemical compound with the molecular formula C11H7F2NO2 and a molecular weight of 223.17 g/mol. IUPAC name: 4-[(2,4-difluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one. InChIKey: OMPNCCVEPLPBEJ-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO2 |
|---|---|
| Molecular weight | 223.17 g/mol |
| IUPAC name | 4-[(2,4-difluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
| InChIKey | OMPNCCVEPLPBEJ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC2=C(C=C(C=C2)F)F)C(=O)O1 |
Computed by PubChem (NCBI)