CAS 2270912-84-8 is the registry number for 4-Hydroxy-n-isopropyl-3-(2,2,2-trifluoro-ethoxy)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-hydroxy-N-propan-2-yl-3-(2,2,2-trifluoroethoxy)benzamide (CAS 2270912-84-8) is a chemical compound with the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. IUPAC name: 4-hydroxy-N-propan-2-yl-3-(2,2,2-trifluoroethoxy)benzamide. InChIKey: CLABBWXLSLBPEO-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO3 |
|---|---|
| Molecular weight | 277.24 g/mol |
| IUPAC name | 4-hydroxy-N-propan-2-yl-3-(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | CLABBWXLSLBPEO-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC(=C(C=C1)O)OCC(F)(F)F |
Computed by PubChem (NCBI)