CAS 850035-17-5 is the registry number for N,N-Diethyl-4-hydroxy-2-(trifluoromethoxy)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N,N-diethyl-4-hydroxy-2-(trifluoromethoxy)benzamide (CAS 850035-17-5) is a chemical compound with the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. IUPAC name: N,N-diethyl-4-hydroxy-2-(trifluoromethoxy)benzamide. InChIKey: SLLLUMCOSNVMQU-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO3 |
|---|---|
| Molecular weight | 277.24 g/mol |
| IUPAC name | N,N-diethyl-4-hydroxy-2-(trifluoromethoxy)benzamide |
| InChIKey | SLLLUMCOSNVMQU-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=C(C=C1)O)OC(F)(F)F |
Computed by PubChem (NCBI)