CAS 2270913-24-9 is the registry number for 3-Bromo-n,n-dimethyl-5-(propane-2-sulfonylamino)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-bromo-N,N-dimethyl-5-(propan-2-ylsulfonylamino)benzamide (CAS 2270913-24-9) is a chemical compound with the molecular formula C12H17BrN2O3S and a molecular weight of 349.25 g/mol. IUPAC name: 3-bromo-N,N-dimethyl-5-(propan-2-ylsulfonylamino)benzamide. InChIKey: VSJSWBZEZLBANE-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O3S |
|---|---|
| Molecular weight | 349.25 g/mol |
| IUPAC name | 3-bromo-N,N-dimethyl-5-(propan-2-ylsulfonylamino)benzamide |
| InChIKey | VSJSWBZEZLBANE-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)NC1=CC(=CC(=C1)C(=O)N(C)C)Br |
Computed by PubChem (NCBI)