CAS 524718-84-1 is the registry number for 2-(4-(4-Bromobenzenesulfonyl)piperazin-1-yl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethanol (CAS 524718-84-1) is a chemical compound with the molecular formula C12H17BrN2O3S and a molecular weight of 349.25 g/mol. IUPAC name: 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethanol. InChIKey: ZFNQGKTVXQQEEJ-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O3S |
|---|---|
| Molecular weight | 349.25 g/mol |
| IUPAC name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethanol |
| InChIKey | ZFNQGKTVXQQEEJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCO)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)