Products 2270984-21-7

CAS 2270984-21-7 is the registry number for Gcase activator 3, 99.67%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 25 mg, 5 mg, 10 mg, 10mM/1mL, 50 mg.

Structural formula: {0} (CAS {1})

N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-methyl-2-pyridin-3-ylquinazolin-4-amine (CAS 2270984-21-7) is a chemical compound with the molecular formula C23H20N4O2 and a molecular weight of 384.4 g/mol. IUPAC name: N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-methyl-2-pyridin-3-ylquinazolin-4-amine. InChIKey: JFOVNJQCUHRYOI-KRWDZBQOSA-N.

Identity
Molecular formulaC23H20N4O2
Molecular weight384.4 g/mol
IUPAC nameN-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-methyl-2-pyridin-3-ylquinazolin-4-amine
InChIKeyJFOVNJQCUHRYOI-KRWDZBQOSA-N
SMILESCN(C[C@H]1COC2=CC=CC=C2O1)C3=NC(=NC4=CC=CC=C43)C5=CN=CC=C5

Computed by PubChem (NCBI)