Products 480425-25-0
CAS 480425-25-0 appears in our catalog under these names: Disperse yellow 7 methacrylate, DISPERSE YELLOW 7 METHACRYLATE, 95%, DISPERSE YELLOW 7 METHACRYLATE 96, ≥95%. Offered by: Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g, 250MG, 50mg.
[2-methyl-4-[(4-phenyldiazenylphenyl)diazenyl]phenyl] 2-methylprop-2-enoate (CAS 480425-25-0) is a chemical compound with the molecular formula C23H20N4O2 and a molecular weight of 384.4 g/mol. IUPAC name: [2-methyl-4-[(4-phenyldiazenylphenyl)diazenyl]phenyl] 2-methylprop-2-enoate. InChIKey: NLSOMFRHHRRNDW-UHFFFAOYSA-N.
| Molecular formula | C23H20N4O2 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | [2-methyl-4-[(4-phenyldiazenylphenyl)diazenyl]phenyl] 2-methylprop-2-enoate |
| InChIKey | NLSOMFRHHRRNDW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N=NC2=CC=C(C=C2)N=NC3=CC=CC=C3)OC(=O)C(=C)C |
Computed by PubChem (NCBI)