CAS 22711-23-5 appears in our catalog under these names: 4-Chlorobenzil 95%, 1-(4-Chlorophenyl)-2-phenylethane-1,2-dione, 98%, 98%, 1-(4-Chlorophenyl)-2-phenylethane-1,2-dione, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(4-chlorophenyl)-2-phenylethane-1,2-dione (CAS 22711-23-5) is a chemical compound with the molecular formula C14H9ClO2 and a molecular weight of 244.67 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-phenylethane-1,2-dione. InChIKey: QDCKVAZDINMMHO-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO2 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-phenylethane-1,2-dione |
| InChIKey | QDCKVAZDINMMHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)