CAS 39148-58-8 appears in our catalog under these names: 4-Benzoylbenzoyl chloride, 98%, 4-Benzoylbenzoyl chloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg.
4-benzoylbenzoyl chloride (CAS 39148-58-8) is a chemical compound with the molecular formula C14H9ClO2 and a molecular weight of 244.67 g/mol. IUPAC name: 4-benzoylbenzoyl chloride. InChIKey: OZCULFZQSHFJNI-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO2 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 4-benzoylbenzoyl chloride |
| InChIKey | OZCULFZQSHFJNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)