Products 2271196-32-6
CAS 2271196-32-6 is the registry number for 6-Chloro-3-(10-methoxyphenanthren-9-yl)pyrazin-2-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-chloro-3-(10-methoxyphenanthren-9-yl)pyrazin-2-amine (CAS 2271196-32-6) is a chemical compound with the molecular formula C19H14ClN3O and a molecular weight of 335.8 g/mol. IUPAC name: 6-chloro-3-(10-methoxyphenanthren-9-yl)pyrazin-2-amine. InChIKey: GWIHZCMYCGPALR-UHFFFAOYSA-N.
| Molecular formula | C19H14ClN3O |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 6-chloro-3-(10-methoxyphenanthren-9-yl)pyrazin-2-amine |
| InChIKey | GWIHZCMYCGPALR-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=CC=CC=C2C3=CC=CC=C31)C4=NC=C(N=C4N)Cl |
Computed by PubChem (NCBI)