Products 1000933-67-4
CAS 1000933-67-4 is the registry number for 2-(Chloromethyl)-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-(chloromethyl)-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine (CAS 1000933-67-4) is a chemical compound with the molecular formula C19H14ClN3O and a molecular weight of 335.8 g/mol. IUPAC name: 2-(chloromethyl)-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine. InChIKey: FMEVTKZWXSFLTQ-UHFFFAOYSA-N.
| Molecular formula | C19H14ClN3O |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 2-(chloromethyl)-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine |
| InChIKey | FMEVTKZWXSFLTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC3=NC(=NC(=C23)N)CCl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)