Products 2271371-53-8
CAS 2271371-53-8 is the registry number for 4-Amino-2-fluoro-3,5-diisopropylbenzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-2-fluoro-3,5-di(propan-2-yl)benzonitrile (CAS 2271371-53-8) is a chemical compound with the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. IUPAC name: 4-amino-2-fluoro-3,5-di(propan-2-yl)benzonitrile. InChIKey: IFHIBKJHSJMTAX-UHFFFAOYSA-N.
| Molecular formula | C13H17FN2 |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 4-amino-2-fluoro-3,5-di(propan-2-yl)benzonitrile |
| InChIKey | IFHIBKJHSJMTAX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C(=C1)C#N)F)C(C)C)N |
Computed by PubChem (NCBI)