CAS 2377355-03-6 is the registry number for (S)-6-Fluoro-1,3-dihydrospiro[indene-2,4'-piperidin]-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-6-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine (CAS 2377355-03-6) is a chemical compound with the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. IUPAC name: (1S)-6-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine. InChIKey: PBUYNCKWEHUKNV-GFCCVEGCSA-N.
| Molecular formula | C13H17FN2 |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | (1S)-6-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine |
| InChIKey | PBUYNCKWEHUKNV-GFCCVEGCSA-N |
| SMILES | C1CNCCC12CC3=C([C@H]2N)C=C(C=C3)F |
Computed by PubChem (NCBI)