Products 2271393-78-1
CAS 2271393-78-1 is the registry number for 2,4,5,6-Tetrahydro-1H-cyclobuta[f]inden-3-amine, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Tricyclo[6.3.0.03,6]undeca-1,3(6),7-trien-2-amine (CAS 2271393-78-1) is a chemical compound with the molecular formula C11H13N and a molecular weight of 159.23 g/mol. IUPAC name: tricyclo[6.3.0.03,6]undeca-1,3(6),7-trien-2-amine. InChIKey: ALDYYUMPYDZGRT-UHFFFAOYSA-N.
| Molecular formula | C11H13N |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | tricyclo[6.3.0.03,6]undeca-1,3(6),7-trien-2-amine |
| InChIKey | ALDYYUMPYDZGRT-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(CC3)C(=C2C1)N |
Computed by PubChem (NCBI)