CAS 2271478-53-4 is the registry number for Rel-(1R,2S)-2-(benzyloxy)cyclobutan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,2S)-2-phenylmethoxycyclobutan-1-amine (CAS 2271478-53-4) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: cis-(1R,2S)-2-phenylmethoxycyclobutan-1-amine. InChIKey: PWZQZJTVISDNTA-MNOVXSKESA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | cis-(1R,2S)-2-phenylmethoxycyclobutan-1-amine |
| InChIKey | PWZQZJTVISDNTA-MNOVXSKESA-N |
| SMILES | C1C[C@@H]([C@@H]1N)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)