CAS 777040-68-3 is the registry number for (1S,2R)-2-(Benzyloxy)cyclobutanamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,2R)-2-phenylmethoxycyclobutan-1-amine (CAS 777040-68-3) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: cis-(1S,2R)-2-phenylmethoxycyclobutan-1-amine. InChIKey: PWZQZJTVISDNTA-WDEREUQCSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | cis-(1S,2R)-2-phenylmethoxycyclobutan-1-amine |
| InChIKey | PWZQZJTVISDNTA-WDEREUQCSA-N |
| SMILES | C1C[C@H]([C@H]1N)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)