CAS 227199-09-9 is the registry number for 2-Isopropyl-n,n,6-trimethylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N,N,2-trimethyl-6-propan-2-ylaniline (CAS 227199-09-9) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: N,N,2-trimethyl-6-propan-2-ylaniline. InChIKey: XTYKPEMLMDLYKC-UHFFFAOYSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | N,N,2-trimethyl-6-propan-2-ylaniline |
| InChIKey | XTYKPEMLMDLYKC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)C)N(C)C |
Computed by PubChem (NCBI)