CAS 854181-07-0 appears in our catalog under these names: 2,2-Dimethyl-1-(3-methylphenyl)propan-1-amine, 95%, 2,2-Dimethyl-1-(3-methylphenyl)propan-1-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2,2-dimethyl-1-(3-methylphenyl)propan-1-amine (CAS 854181-07-0) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: 2,2-dimethyl-1-(3-methylphenyl)propan-1-amine. InChIKey: YNRFBIYHHSTFGJ-UHFFFAOYSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | 2,2-dimethyl-1-(3-methylphenyl)propan-1-amine |
| InChIKey | YNRFBIYHHSTFGJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(C(C)(C)C)N |
Computed by PubChem (NCBI)