CAS 2272024-58-3 is the registry number for Moxifloxacin Impurity 51. Offered by: Chemat Brand. Available pack sizes: on request.
(4aR,7aS)-6-benzyl-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one (CAS 2272024-58-3) is a chemical compound with the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. IUPAC name: (4aR,7aS)-6-benzyl-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one. InChIKey: ZLWCCFOGFMYOTP-CHWSQXEVSA-N.
| Molecular formula | C14H18N2O |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | (4aR,7aS)-6-benzyl-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one |
| InChIKey | ZLWCCFOGFMYOTP-CHWSQXEVSA-N |
| SMILES | C1C[C@@H]2[C@@H](CN(C2=O)CC3=CC=CC=C3)NC1 |
Computed by PubChem (NCBI)