CAS 22726-30-3 appears in our catalog under these names: 7–Methoxy–1,4–benzothiazin–3–one, 7-Methoxy-1,4-benzothiazin-3-one, 95%, 7-METHOXY-1,4-BENZOTHIAZIN-3-ONE, 97%, 7-Methoxy-2H-benzo[b][1,4]thiazin-3(4H)-one, 97%, 97%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 10g.
7-methoxy-4H-1,4-benzothiazin-3-one (CAS 22726-30-3) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 7-methoxy-4H-1,4-benzothiazin-3-one. InChIKey: ZITGVVWIRFDIBZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 7-methoxy-4H-1,4-benzothiazin-3-one |
| InChIKey | ZITGVVWIRFDIBZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)CS2 |
Computed by PubChem (NCBI)