CAS 22753-80-6 is the registry number for 2-(2,2,2-Trifluoroethylamino)-5-chlorobenzophenone. Offered by: TRC. Available pack sizes: 100mg.
[5-chloro-2-(2,2,2-trifluoroethylamino)phenyl]-phenylmethanone (CAS 22753-80-6) is a chemical compound with the molecular formula C15H11ClF3NO and a molecular weight of 313.70 g/mol. IUPAC name: [5-chloro-2-(2,2,2-trifluoroethylamino)phenyl]-phenylmethanone. InChIKey: MKBQTVZIYPYTSC-UHFFFAOYSA-N.
| Molecular formula | C15H11ClF3NO |
|---|---|
| Molecular weight | 313.70 g/mol |
| IUPAC name | [5-chloro-2-(2,2,2-trifluoroethylamino)phenyl]-phenylmethanone |
| InChIKey | MKBQTVZIYPYTSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)NCC(F)(F)F |
Computed by PubChem (NCBI)