CAS 253663-53-5 is the registry number for Efavirenz 3-Desoxy. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1,3-dihydroquinolin-2-one (CAS 253663-53-5) is a chemical compound with the molecular formula C15H11ClF3NO and a molecular weight of 313.70 g/mol. IUPAC name: 6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1,3-dihydroquinolin-2-one. InChIKey: VZMTWEKKZZHRRG-UHFFFAOYSA-N.
| Molecular formula | C15H11ClF3NO |
|---|---|
| Molecular weight | 313.70 g/mol |
| IUPAC name | 6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1,3-dihydroquinolin-2-one |
| InChIKey | VZMTWEKKZZHRRG-UHFFFAOYSA-N |
| SMILES | C1CC1C#CC2(CC(=O)NC3=C2C=C(C=C3)Cl)C(F)(F)F |
Computed by PubChem (NCBI)