Products 2275601-87-9
CAS 2275601-87-9 appears in our catalog under these names: MU1210, MU1210, 99.50%, MU1210 >= 98 % HPLC 25 Mg, MU1210 >= 98 % HPLC 5 Mg. Offered by: GLPBio, MedChemExpress, Sigma-Aldrich. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 25MG.
5-(1-methylpyrazol-4-yl)-3-(3-pyridin-4-ylphenyl)furo[3,2-b]pyridine (CAS 2275601-87-9) is a chemical compound with the molecular formula C22H16N4O and a molecular weight of 352.4 g/mol. IUPAC name: 5-(1-methylpyrazol-4-yl)-3-(3-pyridin-4-ylphenyl)furo[3,2-b]pyridine. InChIKey: HEAGNKNMQVIVMM-UHFFFAOYSA-N.
| Molecular formula | C22H16N4O |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 5-(1-methylpyrazol-4-yl)-3-(3-pyridin-4-ylphenyl)furo[3,2-b]pyridine |
| InChIKey | HEAGNKNMQVIVMM-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NC3=C(C=C2)OC=C3C4=CC=CC(=C4)C5=CC=NC=C5 |
Computed by PubChem (NCBI)